60657-70-7 Usage
General Description
2-Methyl-5-octyn-4-ol is a chemical compound with the molecular formula C9H16O. It is a colorless liquid with a faint odor, and it is commonly used in the production of fragrances and flavors. This chemical is also used in the synthesis of pharmaceuticals and other organic compounds. Its chemical structure contains a terminal alkyne group, which makes it reactive and suitable for use in organic chemistry reactions. 2-Methyl-5-octyn-4-ol is known for its ability to act as a flavoring agent and is often used to add a fruity, citrus-like note to perfumes, colognes, and other scented products. Additionally, it has been studied for its potential as a bioactive compound with antimicrobial and antifungal properties.
Check Digit Verification of cas no
The CAS Registry Mumber 60657-70-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,6,5 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 60657-70:
(7*6)+(6*0)+(5*6)+(4*5)+(3*7)+(2*7)+(1*0)=127
127 % 10 = 7
So 60657-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H16O/c1-4-5-6-9(10)7-8(2)3/h8-10H,4,7H2,1-3H3
