61690-08-2 Usage
General Description
1-Methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole is a chemical compound with the molecular formula C14H14N4S. It is a benzimidazole derivative that contains a thiazole ring. 1-METHYL-2-[(4-METHYL-1,3-THIAZOL-2-YL)METHYL]-1H-BENZIMIDAZOLE has potential use in pharmaceutical research and development due to its structural features and potential biological activities. Benzimidazole derivatives have been studied for their various pharmacological properties, including antiviral, anti-inflammatory, antimicrobial, and anticancer activities. Further research is needed to fully understand the potential applications and biological effects of 1-methyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1H-benzimidazole.
Check Digit Verification of cas no
The CAS Registry Mumber 61690-08-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,6,9 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 61690-08:
(7*6)+(6*1)+(5*6)+(4*9)+(3*0)+(2*0)+(1*8)=122
122 % 10 = 2
So 61690-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N3S/c1-9-8-17-13(14-9)7-12-15-10-5-3-4-6-11(10)16(12)2/h3-6,8H,7H2,1-2H3