61969-53-7 Usage
General Description
2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide is a chemical compound with the molecular formula C9H11NO4. It is a derivative of salicylic acid and contains two hydroxyl groups and an amide functional group. 2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide may have potential pharmaceutical applications due to its structural similarity to salicylic acid, which is known for its anti-inflammatory and analgesic properties. Additionally, the presence of the amide group suggests potential for interactions with biological targets, making it a possible candidate for drug development. The compound's hydroxyl groups also indicate potential for antioxidant activity. Overall, 2,5-Dihydroxy-N-(2-hydroxyethyl)benzamide holds promise for further study in the fields of pharmacology, medicinal chemistry, and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 61969-53-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,9,6 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 61969-53:
(7*6)+(6*1)+(5*9)+(4*6)+(3*9)+(2*5)+(1*3)=157
157 % 10 = 7
So 61969-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO4/c11-4-3-10-9(14)7-5-6(12)1-2-8(7)13/h1-2,5,11-13H,3-4H2,(H,10,14)