62130-80-7 Usage
Description
(H-CYS-PHE-OH)2, also known as cysteine-phenylalanine dimer, is a dimer of the dipeptide H-Cys-Phe-OH. It is composed of two molecules of the dipeptide bonded together, with cysteine being an amino acid known for its role in the formation of disulfide bonds in proteins and phenylalanine being an essential amino acid involved in the synthesis of proteins. The dimerization of these two dipeptide molecules results in the formation of a larger peptide structure with potential applications in biochemistry, medicine, and pharmaceutical research. (H-CYS-PHE-OH)2 may have functional and structural importance in the body and could potentially be used in the development of new drugs or therapeutic treatments.
Uses
Used in Pharmaceutical Research:
(H-CYS-PHE-OH)2 is used as a research compound for investigating its potential applications in drug development. Its unique structure and properties make it a promising candidate for the creation of new therapeutic agents.
Used in Biochemistry:
(H-CYS-PHE-OH)2 is used as a model compound for studying the interactions between amino acids and the formation of peptide bonds. This can help researchers understand the fundamental processes of protein synthesis and folding.
Used in Medicine:
(H-CYS-PHE-OH)2 is used as a potential therapeutic agent for the treatment of various medical conditions. Its functional and structural importance in the body suggests that it may have beneficial effects on health and disease management.
Check Digit Verification of cas no
The CAS Registry Mumber 62130-80-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,1,3 and 0 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 62130-80:
(7*6)+(6*2)+(5*1)+(4*3)+(3*0)+(2*8)+(1*0)=87
87 % 10 = 7
So 62130-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N4O6S2/c25-17(21(29)27-19(23(31)32)11-15-7-3-1-4-8-15)13-35-36-14-18(26)22(30)28-20(24(33)34)12-16-9-5-2-6-10-16/h1-10,17-20H,11-14,25-26H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34)