6294-72-0 Usage
General Description
METHYL 3-AMINO-5,6-DIMETHYLPYRAZINE-2-CARBOXYLATE is a chemical compound with the molecular formula C9H14N4O2. It is a pyrazine derivative with a methyl ester functional group and an amino group on the third carbon. METHYL 3-AMINO-5,6-DIMETHYLPYRAZINE-2-CARBOXYLATE is commonly used in the food and fragrance industry as a flavoring agent due to its characteristic odor and taste. It is also used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. METHYL 3-AMINO-5,6-DIMETHYLPYRAZINE-2-CARBOXYLATE is known for its high stability and compatibility with other compounds, making it a versatile and valuable ingredient in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6294-72-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,9 and 4 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6294-72:
(6*6)+(5*2)+(4*9)+(3*4)+(2*7)+(1*2)=110
110 % 10 = 0
So 6294-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3O2/c1-4-5(2)11-7(9)6(10-4)8(12)13-3/h1-3H3,(H2,9,11)
6294-72-0Relevant articles and documents
HETERO-FUSED CYCLIC COMPOUND
-
Paragraph 0313; 0314; 0315, (2016/07/05)
A compound represented by the formula (I) or a salt thereof: wherein a ring Z is a 5 to 6-membered heteroaromatic ring having one or two heteroatoms in the ring; X1 is a hydrogen atom, a hydroxy group, a hydroxy C1-6 alkyl group, —B(OH)2, a boronate ester group, a cyclic boronate ester group, a boranyl group, a cyclic boranyl group, —BF3Mn1, —Sn(R12)(R13)(R14), a leaving group, a carboxy group, a formyl group, or —NR16R17; and X2 is a hydrogen atom or —CO2R18.
