63059-36-9 Usage
Description
3-butyl-5-[3-[1-butyl-3-(carboxymethyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-5-yl]allylidene]tetrahydro-2,4,6-trioxo-2H-pyrimidine-1-acetic acid is a complex organic compound that is a derivative of pyrimidine. It features multiple functional groups, including carboxyl, hydroxyl, and ketone groups, as well as butyl groups, indicating the presence of long-chain hydrocarbons. The specific properties, uses, and potential applications of this compound would require further analysis and research to be fully understood.
Uses
Used in Pharmaceutical Industry:
3-butyl-5-[3-[1-butyl-3-(carboxymethyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-5-yl]allylidene]tetrahydro-2,4,6-trioxo-2H-pyrimidine-1-acetic acid is used as a pharmaceutical compound for its potential therapeutic effects. The presence of various functional groups may allow it to interact with biological targets, making it a candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, 3-butyl-5-[3-[1-butyl-3-(carboxymethyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-5-yl]allylidene]tetrahydro-2,4,6-trioxo-2H-pyrimidine-1-acetic acid serves as a subject for studying the properties and reactions of complex organic molecules. Its unique structure may provide insights into new chemical reactions and mechanisms.
Used in Material Science:
3-butyl-5-[3-[1-butyl-3-(carboxymethyl)-1,2,3,4-tetrahydro-6-hydroxy-2,4-dioxopyrimidin-5-yl]allylidene]tetrahydro-2,4,6-trioxo-2H-pyrimidine-1-acetic acid may also find applications in material science, where its structural features could be utilized to develop new materials with specific properties, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 63059-36-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,5 and 9 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 63059-36:
(7*6)+(6*3)+(5*0)+(4*5)+(3*9)+(2*3)+(1*6)=119
119 % 10 = 9
So 63059-36-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H28N4O10/c1-3-5-10-24-18(32)14(20(34)26(22(24)36)12-16(28)29)8-7-9-15-19(33)25(11-6-4-2)23(37)27(21(15)35)13-17(30)31/h7-9,14H,3-6,10-13H2,1-2H3,(H,28,29)(H,30,31)