63430-98-8 Usage
General Description
L-1,2,3,4-Tetrahydro-quinoline-2-carboxylic acid hydrochloride is a chemical compound that contains a tetrahydroquinoline ring structure and a carboxylic acid functional group. It is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and drug candidates. L-1,2,3,4-Tetrahydro-quinoline-2-carboxylic acid hydrochloride is often utilized in the development of potential treatments for neurological disorders, cancer, and other medical conditions. The hydrochloride salt form of L-1,2,3,4-Tetrahydro-quinoline-2-carboxylic acid is typically more stable and soluble, making it easier to work with in laboratory settings. Overall, this chemical plays a crucial role in drug discovery and development due to its versatile applications in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 63430-98-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,3 and 0 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 63430-98:
(7*6)+(6*3)+(5*4)+(4*3)+(3*0)+(2*9)+(1*8)=118
118 % 10 = 8
So 63430-98-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.ClH/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H/t9-;/m0./s1
63430-98-8Relevant articles and documents
1-[Acylthio) and (mercapto)-1-oxoalkyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acids
-
, (2008/06/13)
A series of 1-[acylthio) and (mercapto)-1-oxoalkyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acids and salts thereof are useful as Angiotensin I converting enzyme inhibitors.