63689-59-8 Usage
Description
2,6-DIKETO-13-THIA-18-CROWN-6 is a heterocyclic compound that belongs to the family of crown ethers. It is a macrocyclic compound with six oxygen and two sulfur atoms forming a 13-membered ring. 2,6-DIKETO-13-THIA-18-CROWN-6 is known for its ability to selectively bind and transport metal ions, particularly alkali and alkaline earth metal ions.
Uses
Used in Chemistry and Materials Science:
2,6-DIKETO-13-THIA-18-CROWN-6 is used as a chelating agent for metal ion extraction due to its selective binding and transport properties for metal ions.
2,6-DIKETO-13-THIA-18-CROWN-6 is used as a sensor for metal ion detection, leveraging its ability to selectively bind metal ions.
2,6-DIKETO-13-THIA-18-CROWN-6 is used as a potential drug carrier for targeted delivery of metal ions, taking advantage of its unique structure and metal ion binding properties.
Check Digit Verification of cas no
The CAS Registry Mumber 63689-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,8 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63689-59:
(7*6)+(6*3)+(5*6)+(4*8)+(3*9)+(2*5)+(1*9)=168
168 % 10 = 8
So 63689-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H20O7S/c13-11-9-17-10-12(14)19-4-2-16-6-8-20-7-5-15-1-3-18-11/h1-10H2