63886-92-0 Usage
General Description
N,N-DIETHYL-2-(2'-HYDROXYETHOXY)BENZAMIDE is a chemical compound that is commonly used in the research and development of pharmaceutical drugs. It belongs to the class of benzamides, which are known for their analgesic and anti-inflammatory properties. This particular compound is a derivative of benzamide and contains a diethyl and hydroxyethoxy group, enhancing its solubility and bioavailability. It is often used as a building block in the synthesis of potential drug candidates, especially those targeting the central and peripheral nervous systems. Additionally, it has been studied for its potential in treating various medical conditions, such as pain, inflammation, and neurodegenerative diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 63886-92-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,8 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 63886-92:
(7*6)+(6*3)+(5*8)+(4*8)+(3*6)+(2*9)+(1*2)=170
170 % 10 = 0
So 63886-92-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO3/c1-3-14(4-2)13(16)11-7-5-6-8-12(11)17-10-9-15/h5-8,15H,3-4,9-10H2,1-2H3
