64339-42-0 Usage
General Description
H-TRP-ILE-OH is a chemical compound consisting of the amino acids tryptophan and isoleucine, linked together by peptide bonds. Tryptophan is an essential amino acid that plays a crucial role in protein synthesis and is also a precursor for the synthesis of neurotransmitters such as serotonin and melatonin. Isoleucine is another essential amino acid that is important for muscle metabolism and energy production. H-TRP-ILE-OH is often used in biochemical research and drug development due to its potential in influencing cellular functions and signaling pathways related to protein synthesis and neurotransmitter production. Additionally, it may have applications in the development of pharmaceuticals targeting conditions related to serotonin and melatonin imbalances, as well as muscle metabolism and energy regulation.
Check Digit Verification of cas no
The CAS Registry Mumber 64339-42-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,3,3 and 9 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 64339-42:
(7*6)+(6*4)+(5*3)+(4*3)+(3*9)+(2*4)+(1*2)=130
130 % 10 = 0
So 64339-42-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H23N3O3/c1-3-10(2)15(17(22)23)20-16(21)13(18)8-11-9-19-14-7-5-4-6-12(11)14/h4-7,9-10,13,15,19H,3,8,18H2,1-2H3,(H,20,21)(H,22,23)/t10?,13?,15-/m0/s1
