644-40-6 Usage
General Description
1H-Purine-2,8-diamine (9CI) is a chemical compound with the molecular formula C5H6N6. It is a purine derivative with a diamine group attached at the 2 and 8 positions of the purine ring. 1H-Purine-2,8-diamine (9CI) is a key building block in the synthesis of various pharmaceuticals and organic compounds. It has been studied for its potential biological and pharmacological activities, including its role in cancer research and as a potential therapeutic agent for various diseases. Additionally, this compound has also been used in the development of new materials and in the field of organic chemistry for the synthesis of novel compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 644-40-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,4 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 644-40:
(5*6)+(4*4)+(3*4)+(2*4)+(1*0)=66
66 % 10 = 6
So 644-40-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N6/c6-4-8-1-2-3(10-4)11-5(7)9-2/h1H,(H5,6,7,8,9,10,11)
