654-41-1 Usage
General Description
4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl- (9CI) is a chemical compound that consists of a pyrimidine ring with a fluorine atom at the 5th position and two methyl groups at the 2nd and 6th positions. It is a heterocyclic compound with potential pharmaceutical and industrial applications. This chemical compound is known for its diverse biological activities, including anti-inflammatory, antiviral, and antitumor properties. It is also used as a building block in the synthesis of various pharmaceutical drugs and organic compounds. Additionally, 4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl- (9CI) is used in research and development for the discovery of new drugs and materials due to its unique structural properties and potential pharmacological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 654-41-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 654-41:
(5*6)+(4*5)+(3*4)+(2*4)+(1*1)=71
71 % 10 = 1
So 654-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H7FN2O/c1-3-5(7)6(10)9-4(2)8-3/h1-2H3,(H,8,9,10)