65536-40-5 Usage
General Description
N-(2-chloroethyl)-N'-(4-methoxyphenyl)urea is a chemical compound with the molecular formula C10H12ClN3O2. It is a urea derivative with a chloroethyl group attached to one nitrogen atom and a 4-methoxyphenyl group attached to the other nitrogen atom. N-(2-CHLOROETHYL)-N'-(4-METHOXYPHENYL)UREA has potential use as a synthetic intermediate in organic chemistry, particularly in the synthesis of pharmaceuticals or other biologically active compounds. It may also have applications in the field of agriculture or as a building block for the development of new materials. Its specific properties and potential uses would need to be further investigated through experimentation and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 65536-40-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,5,3 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 65536-40:
(7*6)+(6*5)+(5*5)+(4*3)+(3*6)+(2*4)+(1*0)=135
135 % 10 = 5
So 65536-40-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H13ClN2O2/c1-15-9-4-2-8(3-5-9)13-10(14)12-7-6-11/h2-5H,6-7H2,1H3,(H2,12,13,14)
