65542-24-7 Usage
General Description
N-Methyl-4-chlorobenzylamine hydrochloride is a chemical compound that is commonly used in pharmaceutical and research applications. It is an organic compound with a molecular formula of C8H10ClN·HCl. The presence of the hydrochloride salt makes it a water-soluble compound, which is useful for various biochemical and analytical techniques. N-Methyl-4-chlorobenzylamine hydrochloride is often utilized as an intermediate in the synthesis of pharmaceutical drugs and fine chemicals. It is also used as a reactant in the production of various organic compounds, including specialty materials and agrochemicals. Additionally, N-Methyl-4-chlorobenzylamine hydrochloride is known for its vasodilatory and smooth muscle relaxant effects, making it a potential candidate for the development of therapeutic drugs targeting cardiovascular and muscular disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 65542-24-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,5,4 and 2 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 65542-24:
(7*6)+(6*5)+(5*5)+(4*4)+(3*2)+(2*2)+(1*4)=127
127 % 10 = 7
So 65542-24-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN.ClH/c1-10-6-7-2-4-8(9)5-3-7;/h2-5,10H,6H2,1H3;1H
