664322-03-6 Usage
General Description
The chemical [(6-chloro-2-oxobenzo[d]oxazol-3(2H)-yl)methyl]methyl cyanocarbonylimidodithioate is a complex compound with a long and specific name. It contains a mixture of elements, including chlorine, oxygen, nitrogen, carbon, and sulfur. [(6-CHLORO-2-OXOBENZO[D]OXAZOL-3(2H)-YL)METHYL]METHYL CYANOCARBONIMIDODITHIOATE is a cyanocarbonylimidodithioate, which means it contains a combination of cyano, carbonyl, imido, and dithio functional groups. These groups contribute to its potential chemical reactivity and biological activity, making it important in the field of organic chemistry and potentially in pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 664322-03-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,4,3,2 and 2 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 664322-03:
(8*6)+(7*6)+(6*4)+(5*3)+(4*2)+(3*2)+(2*0)+(1*3)=146
146 % 10 = 6
So 664322-03-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClN3O2S2/c1-18-10(14-5-13)19-6-15-8-3-2-7(12)4-9(8)17-11(15)16/h2-4H,6H2,1H3/b14-10-