66799-93-7 Usage
General Description
7-bromobenzo[d][1,3]dioxole-5-carboxylic acid is a chemical compound with the molecular formula C9H5BrO4. It is a derivative of benzo[d][1,3]dioxole, containing a carboxylic acid group at the 5-position and a bromine substituent at the 7-position. 7-bromobenzo[d][1,3]dioxole-5-carboxylic acid is used in organic synthesis and medicinal chemistry as a building block for the synthesis of various pharmaceuticals, agrochemicals, and other biologically active molecules. Its chemical structure and properties make it a valuable intermediate for the production of complex organic compounds. It is also a useful tool for researchers studying the structure-activity relationships of different chemical entities. Overall, 7-bromobenzo[d][1,3]dioxole-5-carboxylic acid is an important chemical compound with various applications in the field of chemistry and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 66799-93-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,7,9 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 66799-93:
(7*6)+(6*6)+(5*7)+(4*9)+(3*9)+(2*9)+(1*3)=197
197 % 10 = 7
So 66799-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5BrO4/c9-5-1-4(8(10)11)2-6-7(5)13-3-12-6/h1-2H,3H2,(H,10,11)
