671-52-3 Usage
Type of compound
Ester of aziridinecarboxylic acid
Reactivity
Highly reactive
Toxicity
Potentially toxic
Applications
a. Reagent in organic synthesis
b. Preparation of pharmaceuticals and other organic compounds
Coordination chemistry
Forms stable complexes with various metal ions
Handling precautions
Handle with care due to potential toxicity and reactivity
Check Digit Verification of cas no
The CAS Registry Mumber 671-52-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,7 and 1 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 671-52:
(5*6)+(4*7)+(3*1)+(2*5)+(1*2)=73
73 % 10 = 3
So 671-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2/c1-5(2)9-6(8)7-3-4-7/h5H,3-4H2,1-2H3