67442-91-5 Usage
Molecular structure
1-Mercapto-4-(3-methylphenyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one has a complex molecular structure that includes a mercapto group, a quinazolinone ring, a triazolo ring, and a methylphenyl group.
Mercapto group
The mercapto group (also known as a thiol group) is a chemical group consisting of a sulfur atom bonded to a hydrogen atom. It is known for its strong smell and its ability to form covalent bonds with other molecules.
Quinazolinone ring
The quinazolinone ring is a chemical structure that is a part of the larger molecule. It is a five-membered ring system that includes an oxygen atom and a nitrogen atom.
Triazolo ring
The triazolo ring is another five-membered ring system that is part of the complex molecular structure of the compound. It consists of three nitrogen atoms and two carbon atoms.
Methylphenyl group
The methylphenyl group is an aromatic ring system that includes a methyl group (a carbon atom bonded to three hydrogen atoms) attached to a phenyl ring (a six-membered ring system with alternating single and double bonds).
Pharmacological and medicinal applications
1-Mercapto-4-(3-methylphenyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one is of interest for its potential pharmacological and medicinal applications due to its variety of biological activities.
Biological activities
The compound exhibits a range of biological activities, including potential as an anti-cancer, anti-inflammatory, or antimicrobial agent.
Further research
Further research into the properties and potential uses of 1-Mercapto-4-(3-methylphenyl)[1,2,4]triazolo[4,3-a]quinazolin-5(4H)-one is warranted to fully understand its potential as a therapeutic agent.
Check Digit Verification of cas no
The CAS Registry Mumber 67442-91-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,4 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 67442-91:
(7*6)+(6*7)+(5*4)+(4*4)+(3*2)+(2*9)+(1*1)=145
145 % 10 = 5
So 67442-91-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H12N4OS/c1-10-5-4-6-11(9-10)19-14(21)12-7-2-3-8-13(12)20-15(19)17-18-16(20)22/h2-9H,1H3,(H,18,22)