67589-39-3 Usage
General Description
4-Ethoxyphenyl trans-4-propylcyclohexanecarboxylate is a chemical compound that belongs to the ester functional group, consisting of a cyclohexane ring with a propyl group and an ethoxyphenyl group attached to it. It is commonly used as an ingredient in the manufacture of fragrances, flavorings, and pharmaceuticals. 4-ethoxyphenyl trans-4-propylcyclohexanecarboxylate is known for its ability to impart a sweet and floral aroma, making it a popular choice in the production of perfumes and scented products. Additionally, it has been studied for its potential medicinal properties, including anti-inflammatory and antioxidant effects, which could make it a valuable ingredient in the development of pharmaceutical drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 67589-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,5,8 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 67589-39:
(7*6)+(6*7)+(5*5)+(4*8)+(3*9)+(2*3)+(1*9)=183
183 % 10 = 3
So 67589-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H26O3/c1-3-5-14-6-8-15(9-7-14)18(19)21-17-12-10-16(11-13-17)20-4-2/h10-15H,3-9H2,1-2H3
67589-39-3Relevant articles and documents
Liquid crystal 2,3-dicyano-hydroquinone derivatives
-
, (2008/06/13)
Liquid crystal materials for liquid crystal display, having a large negative dielectric anisotropy and maintaining a liquid crystal state at a broad temperature range including room temperature are provided. These materials contain novel compounds expressed by the general formula (I) STR1 wherein X represents STR2 Y represents STR3 R1 and R3 each represent an alkyl group or an alkyloxy group of 1-10 carbon atoms; R2 and R4 each represent an alkyl group of 1-10 carbon atoms; but compounds wherein STR4 are excluded.
