67701-06-8 Usage
General Description
Fatty acids C14-C18 and C16-C18 unsaturated are a group of important organic compounds that are commonly found in natural fats and oils. These fatty acids are composed of carbon chains ranging from 14 to 18 carbon atoms, with some containing unsaturated double bonds. They play a crucial role in biological processes such as energy storage, cell membrane structure, and hormone production. Fatty acids C14-C18 and C16-C18 unsaturated are also used in various industries, such as food, pharmaceuticals, and cosmetics, due to their functional properties and potential health benefits. Overall, these fatty acids are essential components of human and animal nutrition, as well as important raw materials for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 67701-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,7,0 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 67701-06:
(7*6)+(6*7)+(5*7)+(4*0)+(3*1)+(2*0)+(1*6)=128
128 % 10 = 8
So 67701-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-14H,1H2,(H,16,17)/b4-3+,6-5+,8-7+,10-9+,12-11+,14-13+
