67770-79-0 Usage
Description
4-Ethyl-4-butyl-delta-valerolactone is a versatile chemical compound that belongs to the class of lactones, which are cyclic esters. It is characterized by its unique chemical structure and possesses properties that make it valuable in various industries.
Uses
Used in Fragrance and Flavoring Industry:
4-Ethyl-4-butyl-delta-valerolactone is used as a fragrance and flavoring agent for its ability to impart pleasant scents and tastes to various consumer products.
Used in Industrial Applications:
4-ETHYL-4-BUTYL-DELTA-VALEROLACTONE serves as a solvent for a wide range of materials, making it useful in industrial applications where its solvent properties are required.
Used in Pharmaceutical Industry:
4-Ethyl-4-butyl-delta-valerolactone has been studied for its potential use in pharmaceuticals, indicating its possible role in the development of new medications or drug formulations.
Used as a Precursor in Organic Synthesis:
Due to its unique chemical structure, 4-ethyl-4-butyl-delta-valerolactone is utilized as a precursor for the synthesis of other organic compounds, contributing to the advancement of organic chemistry and the creation of new materials.
Check Digit Verification of cas no
The CAS Registry Mumber 67770-79-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,7,7 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 67770-79:
(7*6)+(6*7)+(5*7)+(4*7)+(3*0)+(2*7)+(1*9)=170
170 % 10 = 0
So 67770-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H20O2/c1-3-5-7-11(4-2)8-6-10(12)13-9-11/h3-9H2,1-2H3
