68025-28-5 Usage
General Description
Dodecane-1,1,12,12-tetracarboxylic acid is a chemical compound with the molecular formula C20H32O8. It is a tetracarboxylic acid derivative of dodecane, a straight-chain alkane with 12 carbon atoms. Dodecane-1,1,12,12-tetracarboxylic acid is primarily used in the production of polymers and resins, where it acts as a crosslinking agent to improve the mechanical and thermal properties of the final material. It can also be used as a building block in the synthesis of other organic compounds. Additionally, this chemical may have potential applications in drug delivery systems and as a corrosion inhibitor in metal surfaces. Due to its versatile properties and applications, dodecane-1,1,12,12-tetracarboxylic acid is a valuable compound in the field of organic chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 68025-28-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,2 and 5 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 68025-28:
(7*6)+(6*8)+(5*0)+(4*2)+(3*5)+(2*2)+(1*8)=125
125 % 10 = 5
So 68025-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H26O8/c17-13(18)11(14(19)20)9-7-5-3-1-2-4-6-8-10-12(15(21)22)16(23)24/h11-12H,1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)