68239-82-7 Usage
Description
4-nitrobenzene-1,2-diammonium sulphate is a chemical compound that consists of a nitrobenzene ring with two amino groups and a sulphate group attached to it. It is commonly used as a precursor in the synthesis of various organic compounds, including dyes, pharmaceuticals, and agrochemicals. 4-nitrobenzene-1,2-diammonium sulphate is also used as an intermediate in the production of various industrial chemicals.
Uses
Used in Chemical Synthesis:
4-nitrobenzene-1,2-diammonium sulphate is used as a precursor for the synthesis of various organic compounds, such as dyes, pharmaceuticals, and agrochemicals. Its unique structure allows for versatile chemical reactions, making it a valuable component in the production of a wide range of products.
Used in Industrial Chemical Production:
4-nitrobenzene-1,2-diammonium sulphate serves as an intermediate in the production of various industrial chemicals. Its presence in the synthesis process contributes to the formation of desired end products, highlighting its importance in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 68239-82-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,3 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 68239-82:
(7*6)+(6*8)+(5*2)+(4*3)+(3*9)+(2*8)+(1*2)=157
157 % 10 = 7
So 68239-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O2.H2O4S/c7-5-2-1-4(9(10)11)3-6(5)8;1-5(2,3)4/h1-3H,7-8H2;(H2,1,2,3,4)