68295-45-4 Usage
Description
(R)-(-)-2-(ANILINOMETHYL)PYRROLIDINE is a chiral compound characterized by its specific arrangement of atoms in three-dimensional space. It is an organic molecule with a pyrrolidine ring, to which an anilinomethyl group is attached. (R)-(-)-2-(ANILINOMETHYL)PYRROLIDINE is known for its unique properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
(R)-(-)-2-(ANILINOMETHYL)PYRROLIDINE is used as a chiral auxiliary for the synthesis of various pharmaceutical compounds. Its ability to influence the stereochemistry of reactions makes it a valuable tool in the development of enantiomerically pure drugs, which are essential for ensuring the desired therapeutic effects and minimizing potential side effects.
Used in Analytical Chemistry:
(R)-(-)-2-(ANILINOMETHYL)PYRROLIDINE is used as a reagent for determining the absolute configuration of amines and α-amino acids by 1H NMR of (R)-O-aryllactic acid amides. This application is crucial in the field of analytical chemistry, as it helps researchers and chemists to accurately determine the stereochemistry of these important biomolecules, which is often critical for their biological activity and function.
Check Digit Verification of cas no
The CAS Registry Mumber 68295-45-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,9 and 5 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68295-45:
(7*6)+(6*8)+(5*2)+(4*9)+(3*5)+(2*4)+(1*5)=164
164 % 10 = 4
So 68295-45-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2/c1-2-5-10(6-3-1)13-9-11-7-4-8-12-11/h1-3,5-6,11-13H,4,7-9H2/t11-/m1/s1
