69677-91-4 Usage
General Description
N-BENZOYL-PHE-ALA-PRO is a chemical compound composed of the amino acids phenylalanine, alanine, and proline, with a benzoyl group attached to the N-terminus. It is commonly used in peptide synthesis and research as a building block for various bioactive peptides. N-BENZOYL-PHE-ALA-PRO has the potential to exert biological activities such as anti-inflammatory, antimicrobial, and antitumor effects, making it a valuable tool in the development of new pharmaceuticals and treatments. Additionally, N-BENZOYL-PHE-ALA-PRO has been studied for its potential role in modulating cellular processes and signaling pathways, showing promise for future therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 69677-91-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,6,7 and 7 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 69677-91:
(7*6)+(6*9)+(5*6)+(4*7)+(3*7)+(2*9)+(1*1)=194
194 % 10 = 4
So 69677-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H27N3O5/c1-16(23(30)27-14-8-13-20(27)24(31)32)25-22(29)19(15-17-9-4-2-5-10-17)26-21(28)18-11-6-3-7-12-18/h2-7,9-12,16,19-20H,8,13-15H2,1H3,(H,25,29)(H,26,28)(H,31,32)