70446-38-7 Usage
General Description
3-ETHYL-2-[(E)-2-(3-((E)-2-[3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE]ETHYLIDENE)-2-PHENYL-1-CYCLOHEXEN-1-YL)ETHENYL]-1,3-BENZOTHIAZOL-3-IUM IODIDE is a complex chemical compound with a long and intricate molecular structure. It contains multiple benzothiazole and ethyl groups, as well as iodide ions. It is a highly conjugated molecule with alternating single and double bonds and contains a positively charged sulfur atom. This chemical may have applications in pharmaceuticals, materials science, or organic synthesis due to its unique structural features and potential reactivity. Further research and analysis would be needed to determine its specific properties and potential uses in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 70446-38-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,4,4 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 70446-38:
(7*7)+(6*0)+(5*4)+(4*4)+(3*6)+(2*3)+(1*8)=117
117 % 10 = 7
So 70446-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C34H33N2S2.HI/c1-3-35-28-17-8-10-19-30(28)37-32(35)23-21-26-15-12-16-27(34(26)25-13-6-5-7-14-25)22-24-33-36(4-2)29-18-9-11-20-31(29)38-33;/h5-11,13-14,17-24H,3-4,12,15-16H2,1-2H3;1H/q+1;/p-1