708-14-5 Usage
General Description
3-OXO-1,3-DIHYDRO-2-BENZOFURAN-1-CARBOXYLIC ACID, also known as Benzofuran-2-carboxylic acid, is a chemical compound with the molecular formula C9H6O4. It is a derivative of benzofuran and belongs to the class of aromatic carboxylic acids. 3-OXO-1,3-DIHYDRO-2-BENZOFURAN-1-CARBOXYLIC ACID is commonly used in the synthesis of various pharmaceuticals and agrochemicals due to its versatile reactivity and ability to undergo a range of reactions. It is also used as a building block in organic synthesis and drug discovery research. Additionally, it has been found to exhibit potential biological activities, making it a valuable compound in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 708-14-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,0 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 708-14:
(5*7)+(4*0)+(3*8)+(2*1)+(1*4)=65
65 % 10 = 5
So 708-14-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H6O4/c10-8(11)7-5-3-1-2-4-6(5)9(12)13-7/h1-4,7H,(H,10,11)