71412-38-9 Usage
Chemical class
Anthraquinone derivatives
Molecular weight
405.36 g/mol
1-amino group
A primary amine group attached to the first carbon of the anthraquinone core
5-hydroxy group
A hydroxyl group attached to the fifth carbon of the anthraquinone core
4-[(2-methoxyphenyl)amino] group
An amino group attached to a 2-methoxyphenyl group, which is further attached to the fourth carbon of the anthraquinone core
8-nitro group
A nitro group (-NO2) attached to the eighth carbon of the anthraquinone core
Organic synthesis
Used as a building block or intermediate in the synthesis of various organic compounds
Pharmaceutical research
Investigated for its potential biological activities, such as anti-tumor and anti-bacterial properties
Textile dyeing
Studied for its potential use in dyeing textiles due to its colorant properties
Colorant in industries
Explored for its use as a colorant in various industries, such as cosmetics and plastics, due to its vibrant color and stability
Check Digit Verification of cas no
The CAS Registry Mumber 71412-38-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,4,1 and 2 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 71412-38:
(7*7)+(6*1)+(5*4)+(4*1)+(3*2)+(2*3)+(1*8)=99
99 % 10 = 9
So 71412-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H15N3O6/c1-30-15-5-3-2-4-11(15)23-12-7-6-10(22)16-17(12)21(27)19-14(25)9-8-13(24(28)29)18(19)20(16)26/h2-9,23,25H,22H2,1H3