71515-82-7 Usage
General Description
Decahydropyrido[1,2-a][1,4]diazepine is a chemical compound with the molecular formula C10H16N2. It is a saturated heterocyclic compound that contains a nitrogen atom within a bicyclic structure. decahydropyrido[1,2-a][1,4]diazepine has potential applications in medicinal chemistry and drug development, as it can serve as a starting material for the synthesis of various pharmacologically active molecules. Decahydropyrido[1,2-a][1,4]diazepine and its derivatives have been studied for their potential biological activities, including anticonvulsant, anxiolytic, and sedative properties. Additionally, this compound may also be used as a building block in the synthesis of natural products and other complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 71515-82-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,5,1 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 71515-82:
(7*7)+(6*1)+(5*5)+(4*1)+(3*5)+(2*8)+(1*2)=117
117 % 10 = 7
So 71515-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H18N2/c1-2-6-11-7-3-5-10-8-9(11)4-1/h9-10H,1-8H2
