71889-72-0 Usage
General Description
6-amidinoindole, also known as 6-amininindole, is a chemical compound that belongs to the indole class of heterocyclic aromatic compounds. It is a derivative of indole with an amidino group at the 6-position. 6-amidinoindole has been studied for its potential pharmaceutical applications, particularly in the field of medicinal chemistry. It has been investigated for its potential as an anticancer agent, as well as its ability to inhibit certain enzymes. Research has also suggested its potential use in the development of new drugs for various medical conditions. Furthermore, 6-amidinoindole has been studied for its photophysical properties and potential applications in the field of materials science. Its unique structure and properties make it a valuable target for further research and development in various scientific disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 71889-72-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,8,8 and 9 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 71889-72:
(7*7)+(6*1)+(5*8)+(4*8)+(3*9)+(2*7)+(1*2)=170
170 % 10 = 0
So 71889-72-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3/c10-9(11)7-2-1-6-3-4-12-8(6)5-7/h1-5,12H,(H3,10,11)