71933-03-4 Usage
General Description
Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate is a chemical compound with the molecular formula C6H5BrN2O4. It is a derivative of pyrimidine, containing a methyl ester group, a bromine atom, and a hydroxyl group. Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate has potential applications in pharmaceutical research and development, particularly in the synthesis of biologically active molecules and drug candidates. Its unique structure and reactivity make it a valuable building block for the synthesis of complex organic compounds and pharmaceuticals. Additionally, it may also have potential uses in the field of agrochemicals and materials science. Overall, Methyl 5-bromo-2-hydroxypyrimidine-4-carboxylate is a versatile and valuable chemical compound with various potential applications in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 71933-03-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,1,9,3 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 71933-03:
(7*7)+(6*1)+(5*9)+(4*3)+(3*3)+(2*0)+(1*3)=124
124 % 10 = 4
So 71933-03-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrN2O3/c1-12-5(10)4-3(7)2-8-6(11)9-4/h2H,1H3,(H,8,9,11)
