72007-47-7 Usage
General Description
The chemical sequence "ALA-PRO-GLY-ASP-ARG-ILE-TYR-VAL-HIS-PRO-PHE" is a polypeptide consisting of 11 amino acids in the following order: Alanine (Ala), Proline (Pro), Glycine (Gly), Aspartic acid (Asp), Arginine (Arg), Isoleucine (Ile), Tyrosine (Tyr), Valine (Val), Histidine (His), Proline (Pro), and Phenylalanine (Phe). This sequence forms a specific arrangement of amino acids, which can play various roles in biological processes such as protein synthesis, enzyme function, and cell signaling. The individual properties and interactions of these amino acids contribute to the overall function and structure of the polypeptide.
Check Digit Verification of cas no
The CAS Registry Mumber 72007-47-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,0,0 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 72007-47:
(7*7)+(6*2)+(5*0)+(4*0)+(3*7)+(2*4)+(1*7)=97
97 % 10 = 7
So 72007-47-7 is a valid CAS Registry Number.
InChI:InChI=1/C60H86N16O15/c1-6-33(4)49(74-50(81)39(15-10-22-65-60(62)63)69-51(82)41(28-47(79)80)68-46(78)30-66-53(84)44-16-11-23-75(44)57(88)34(5)61)56(87)70-40(25-36-18-20-38(77)21-19-36)52(83)73-48(32(2)3)55(86)71-42(27-37-29-64-31-67-37)58(89)76-24-12-17-45(76)54(85)72-43(59(90)91)26-35-13-8-7-9-14-35/h7-9,13-14,18-21,29,31-34,37,39-45,48-49,77H,6,10-12,15-17,22-28,30,61H2,1-5H3,(H,66,84)(H,68,78)(H,69,82)(H,70,87)(H,71,86)(H,72,85)(H,73,83)(H,74,81)(H,79,80)(H,90,91)(H4,62,63,65)/t33-,34-,37?,39-,40-,41-,42-,43-,44-,45-,48-,49-/m0/s1