72133-30-3 Usage
Chemical compound
5-(4-Aminophenoxy)pyridine-2-carboxylic acid dihydrochloride
Commonly used in
research and pharmaceutical development
Intermediate in the synthesis of
various drugs
Used as a reference standard in
analytical chemistry
Dihydrochloride salt of
pyridine-2-carboxylic acid derivative
Chemical structure
contains a pyridine ring with an attached carboxylic acid group and an aminophenoxy substituent
Potential therapeutic applications
due to its ability to modulate biological pathways
Valuable tool for
investigating various physiological processes in cellular and molecular biology research
Dihydrochloride salt form
allows for improved solubility and stability
Makes it
easier to handle and use in laboratory settings
Check Digit Verification of cas no
The CAS Registry Mumber 72133-30-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,3 and 3 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 72133-30:
(7*7)+(6*2)+(5*1)+(4*3)+(3*3)+(2*3)+(1*0)=93
93 % 10 = 3
So 72133-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2O3.2ClH/c13-8-1-3-9(4-2-8)17-10-5-6-11(12(15)16)14-7-10;;/h1-7H,13H2,(H,15,16);2*1H