72138-96-6 Usage
General Description
The chemical 11-(anthraquinon-1-ylamino)anthra[2,1,9-mna]naphth[2,3-h]acridine-5,10,15(16H)-trione, also known as AQ-ANE-NAP, is a complex organic compound. It belongs to the class of anthraquinone dyes and has a unique structure that contains multiple fused aromatic rings. This chemical is commonly used as a fluorescent dye in biological and medical research, as well as in various industrial applications. Its distinctive molecular structure and fluorescent properties make it valuable for visualizing and tracking biological processes and materials. Additionally, AQ-ANE-NAP has potential applications in the development of advanced materials, such as organic semiconductors and optoelectronic devices, due to its unique structural and electronic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 72138-96-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,3 and 8 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 72138-96:
(7*7)+(6*2)+(5*1)+(4*3)+(3*8)+(2*9)+(1*6)=126
126 % 10 = 6
So 72138-96-6 is a valid CAS Registry Number.
InChI:InChI=1/C45H22N2O5/c48-41-25-8-2-1-7-21(25)22-19-20-34-36-23(15-17-30(41)35(22)36)24-16-18-31-39(40(24)47-34)45(52)29-12-6-14-33(38(29)44(31)51)46-32-13-5-11-28-37(32)43(50)27-10-4-3-9-26(27)42(28)49/h1-20,46-47H