72175-33-8 Usage
Description
Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is a complex chemical compound featuring a methyl ester group attached to a bicyclic ring system, with a cyclopentene ring fused to a cyclopropane ring. The molecule also contains an oxirane moiety, indicating the presence of an epoxide functional group. This intricate structure likely endows the compound with unique chemical and physical properties, suggesting potential applications in organic synthesis, medicinal chemistry, or other industrial processes. Further research and analysis are required to fully explore the behavior and potential uses of this compound.
Uses
Used in Organic Synthesis:
Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is used as a key intermediate in organic synthesis for its unique molecular structure and reactivity, allowing for the creation of novel compounds with specific properties.
Used in Medicinal Chemistry:
In the pharmaceutical industry, methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate is used as a building block in the development of new drugs, potentially contributing to the synthesis of bioactive molecules with therapeutic applications.
Used in Industrial Processes:
Methyl 3-bicyclo[2.2.1]hept-5-en-2-yl-3-methyloxirane-2-carboxylate may be utilized in various industrial processes due to its specific chemical properties, such as in the production of specialty chemicals, materials, or as a component in advanced formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 72175-33-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,1,7 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 72175-33:
(7*7)+(6*2)+(5*1)+(4*7)+(3*5)+(2*3)+(1*3)=118
118 % 10 = 8
So 72175-33-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O3/c1-12(10(15-12)11(13)14-2)9-6-7-3-4-8(9)5-7/h3-4,7-10H,5-6H2,1-2H3
