72297-05-3 Usage
Description
7-Aminobenzo[a]pyrene is a chemical compound belonging to the class of polycyclic aromatic amines. It is characterized by its yellow solid appearance and is known for its potentially mutagenic properties, which means it has the ability to cause changes in the genetic information of cells.
Uses
Used in Research and Development:
7-Aminobenzo[a]pyrene is used as a research compound for studying its mutagenic properties and potential effects on genetic information. This application is crucial in understanding the mechanisms of carcinogenesis and the development of cancer.
Used in Environmental Monitoring:
Due to its mutagenic properties, 7-Aminobenzo[a]pyrene can be used as a marker in environmental monitoring to detect the presence of potentially harmful substances in the environment, which can pose risks to human health and the ecosystem.
Used in Pharmaceutical Industry:
7-Aminobenzo[a]pyrene may also be utilized in the pharmaceutical industry for the development of drugs targeting specific genetic mutations or for the creation of compounds that can counteract the mutagenic effects of similar substances.
Used in Chemical Industry:
In the chemical industry, 7-Aminobenzo[a]pyrene could be used as a starting material or intermediate in the synthesis of various complex organic compounds, taking advantage of its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 72297-05-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,2,9 and 7 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72297-05:
(7*7)+(6*2)+(5*2)+(4*9)+(3*7)+(2*0)+(1*5)=133
133 % 10 = 3
So 72297-05-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H13N/c21-18-6-2-5-15-16-10-9-13-4-1-3-12-7-8-14(11-17(15)18)20(16)19(12)13/h1-11H,21H2