72521-00-7 Usage
General Description
6-NITRO-5-METHYL (1H)INDAZOLE is a chemical compound with the molecular formula C8H7N3O2. It is a nitro-substituted indazole derivative that is commonly used in the pharmaceutical and chemical industries for various applications. 6-NITRO-5-METHYL (1H)INDAZOLE is known for its potential as a building block in the synthesis of various biologically active compounds and pharmaceutical agents. It has also been studied for its potential applications in organic synthesis and material science. Additionally, it has been shown to exhibit anticancer and antibacterial properties, which makes it a promising candidate for the development of new drugs. Overall, 6-NITRO-5-METHYL (1H)INDAZOLE is a versatile chemical with diverse uses and potential pharmacological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 72521-00-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,5,2 and 1 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 72521-00:
(7*7)+(6*2)+(5*5)+(4*2)+(3*1)+(2*0)+(1*0)=97
97 % 10 = 7
So 72521-00-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2/c1-5-2-6-4-9-10-7(6)3-8(5)11(12)13/h2-4H,1H3,(H,9,10)
