7253-21-6 Usage
General Description
The chemical 2-[4-[bis[(2,5-dioxopyrrole-1-carbonyl)amino]methyl]phenoxy]acetic acid is a synthetic compound that belongs to the group of carboxylic acids. It contains two dioxopyrrole-1-carbonyl groups, which are known for their potential biological activities. 2-[4-[bis[(2,5-dioxopyrrole-1-carbonyl)amino]methyl]phenoxy]acetic aci d has been synthesized for potential use in pharmaceuticals or as a research tool due to its unique structure and potential biological properties. Its complex structure suggests potential interactions with biological systems, and further research may explore its potential applications in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 7253-21-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,2,5 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7253-21:
(6*7)+(5*2)+(4*5)+(3*3)+(2*2)+(1*1)=86
86 % 10 = 6
So 7253-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H14N4O9/c24-12-5-6-13(25)22(12)18(30)20-17(21-19(31)23-14(26)7-8-15(23)27)10-1-3-11(4-2-10)32-9-16(28)29/h1-8,17H,9H2,(H,20,30)(H,21,31)(H,28,29)