74367-31-0 Usage
General Description
Isobutyric acid 2-ethyl-3-hydroxyhexyl ester is a chemical compound classified as an ester, which is an organic compound made by replacing the hydrogen of an acid by an alkyl or other organic group. This specific compound is derived from isobutyric acid and 2-ethyl-3-hydroxyhexanol. It is primarily used in the synthesis of other complex organic molecules, such as pharmaceuticals or polymers. Like other esters, its properties can change based on the specific composition and structure, and it is typically characterized by strong, fruity odors. However, details on its physical and chemical properties such as solubility, density, boiling and melting point can vary, and specific data about this compound may not be readily available.
Check Digit Verification of cas no
The CAS Registry Mumber 74367-31-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,3,6 and 7 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 74367-31:
(7*7)+(6*4)+(5*3)+(4*6)+(3*7)+(2*3)+(1*1)=140
140 % 10 = 0
So 74367-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H28O3/c1-4-5-6-7-8-9-10-13(15)14(16)17-11-12(2)3/h12-13,15H,4-11H2,1-3H3
