74407-70-8 Usage
General Description
(R)-3-(benzoylthio)-2-methylpropionic acid is a chemical compound that belongs to the class of organic compounds known as phenylthioacetic acid. It is an alpha-methyl branched fatty acid that contains a phenylthio substituent at the third position and a benzoyl group at the first position. (R)-3-(benzoylthio)-2-methylpropionic acid is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and active pharmaceutical ingredients. Its unique structural features make it valuable for the development of new medications and therapeutic agents. Additionally, (R)-3-(benzoylthio)-2-methylpropionic acid has potential applications in organic synthesis and chemical research due to its diverse reactivity and versatility in chemical transformations.
Check Digit Verification of cas no
The CAS Registry Mumber 74407-70-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,0 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 74407-70:
(7*7)+(6*4)+(5*4)+(4*0)+(3*7)+(2*7)+(1*0)=128
128 % 10 = 8
So 74407-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O3S/c1-8(10(12)13)7-15-11(14)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13)/t8-/m0/s1
