74853-69-3 Usage
General Description
AC-ARG-ARG-PRO-TYR-ILE-LEU-OH is a peptide sequence composed of the amino acids arginine (ARG), proline (PRO), tyrosine (TYR), isoleucine (ILE), and leucine (LEU). Peptides are short chains of amino acids linked by peptide bonds and play important roles in various biological processes. This specific peptide sequence may have potential applications in the fields of biochemistry, medicine, and drug development, due to the specific arrangement of amino acids and their potential interactions with other molecules. The presence of arginine and tyrosine in the sequence suggests that this peptide may have the potential to interact with cell membranes or receptor sites, further highlighting its potential as a bioactive compound. Overall, AC-ARG-ARG-PRO-TYR-ILE-LEU-OH holds promise for further study and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 74853-69-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,8,5 and 3 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 74853-69:
(7*7)+(6*4)+(5*8)+(4*5)+(3*3)+(2*6)+(1*9)=163
163 % 10 = 3
So 74853-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C40H66N12O9/c1-6-23(4)32(36(58)50-30(38(60)61)20-22(2)3)51-34(56)29(21-25-13-15-26(54)16-14-25)49-35(57)31-12-9-19-52(31)37(59)28(11-8-18-46-40(43)44)48-33(55)27(47-24(5)53)10-7-17-45-39(41)42/h13-16,22-23,27-32,54H,6-12,17-21H2,1-5H3,(H,47,53)(H,48,55)(H,49,57)(H,50,58)(H,51,56)(H,60,61)(H4,41,42,45)(H4,43,44,46)/t23-,27-,28-,29-,30-,31-,32-/m0/s1
74853-69-3Relevant articles and documents
Corneal therapeutic agent
-
, (2008/06/13)
A corneal therapeutic agent comprises at least one of a hexapeptide and a pharmacologically acceptable salt thereof, represented by formula (I) shown below, and a pharmacologically acceptable carrier, where A is L- or D-arginine or lysine whose N-terminal amino group is deaminated, alkylated or acylated; B is L- or D-arginine, lysine or hystidine; Pro is L- or D-proline; C is L- or D-tyrosine, tryptophane, or phenylalanine; D is L- or D-valine, isoleucine, or leucine having an amino group whose hydrogen atom may be substituted with an alkyl group having 1 to 4 carbon atoms; E is L- or D-valine, isoleucine or leucine having a C-terminal carboxylic group which is unsubstituted or substituted with --COOR, --CH2 OR or --CONHR, where R represents a hydrogen atom or an alkyl group having 1 to 4 carbon atoms.