75080-11-4 Usage
General Description
2-(Butylthio)-1H-benzo[d]imidazole is a chemical compound with the formula C11H14N2S. It belongs to the class of benzo[d]imidazoles, which are heterocyclic compounds with a benzene ring fused to an imidazole ring. 2-(BUTYLTHIO)-1H-BENZO[D]IMIDAZOLE is a potential inhibitor of several enzymes and has been studied for its potential use in treating neurodegenerative diseases. Additionally, it has been of interest in the field of medicinal chemistry for its potential pharmaceutical applications. Its chemical structure and properties make it a subject of interest for further research in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 75080-11-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,0,8 and 0 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 75080-11:
(7*7)+(6*5)+(5*0)+(4*8)+(3*0)+(2*1)+(1*1)=114
114 % 10 = 4
So 75080-11-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2S/c1-2-3-8-14-11-12-9-6-4-5-7-10(9)13-11/h4-7H,2-3,8H2,1H3,(H,12,13)