76808-15-6 Usage
General Description
EBELACTONE B is a chemical compound derived from the plant Euphorbia lathyris L. It is classified as a diterpene and is known for its anti-tumor and anti-inflammatory properties. EBELACTONE B has been shown to inhibit the growth of cancer cells and reduce inflammation in various in vitro and in vivo studies. It is believed to achieve these effects by modulating the expression of key genes and signaling pathways involved in cell growth and inflammation. EBELACTONE B has the potential to be developed into a novel therapeutic agent for cancer and inflammatory diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 76808-15-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,6,8,0 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 76808-15:
(7*7)+(6*6)+(5*8)+(4*0)+(3*8)+(2*1)+(1*5)=156
156 % 10 = 6
So 76808-15-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H36O4/c1-8-13(4)18(22)16(7)19(23)14(5)10-12(3)11-15(6)20-17(9-2)21(24)25-20/h10,13-18,20,22H,8-9,11H2,1-7H3/b12-10+/t13-,14-,15+,16+,17+,18-,20+/m1/s1
76808-15-6Relevant articles and documents
A synthesis of (-)-ebelactones A and B
Cooksey, John P.,Ford, Rhonan,Kocieński, Philip J.,Pelotier, Beatrice,Pons, Jean-Marc
supporting information; experimental part, p. 6462 - 6467 (2010/10/19)
A synthesis of the β-lactone esterase inhibitors (-)-ebelactones A and B is described. The synthesis features the use of a Hoppe homoaldol reaction and a Cu(I)-mediated 1,2-metallate rearrangement of a metallated enol carbamate as key fragment linkage rea