77965-44-7 Usage
Chemical structure
A complex chemical compound with various functional groups, including a benzyloxy group, a chloro group, an indol group, a toluene-4-sulfonate group, a dimethylaminoethyl group, and a methoxycarbonyl group.
Benzyloxy group
A benzyl group attached to an oxygen atom.
Chloro group
A chlorine atom attached to a carbon atom.
Indol group
A bicyclic aromatic ring system with a nitrogen atom in the seven-membered ring.
Toluene-4-sulfonate group
A toluene molecule with a sulfonate group (-SO3H) attached to the fourth carbon.
Dimethylaminoethyl group
An ethyl group with two methyl groups attached to the nitrogen atom.
Methoxycarbonyl group
A carbonyl group (C=O) attached to a methoxy group (-OCH3).
Pharmaceutical research
Due to its diverse chemical properties, the compound may have potential therapeutic applications.
Chemical research
The compound's structure may be used as a catalyst or in the development of new chemical processes.
Fields of interest
The compound's extensive structure provides potential applications in various fields of chemistry and biology, such as medicinal chemistry, synthetic chemistry, and biochemistry.
Research significance
The compound's unique structure and functional groups make it an interesting subject for research, as it may lead to the discovery of new drugs, materials, or chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 77965-44-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,7,9,6 and 5 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 77965-44:
(7*7)+(6*7)+(5*9)+(4*6)+(3*5)+(2*4)+(1*4)=187
187 % 10 = 7
So 77965-44-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H23ClN2O3.C7H8O3S/c1-23(2)11-12-24-18-10-9-16(22)13-17(18)20(19(24)21(25)26-3)27-14-15-7-5-4-6-8-15;1-6-2-4-7(5-3-6)11(8,9)10/h4-10,13H,11-12,14H2,1-3H3;2-5H,1H3,(H,8,9,10)