78892-44-1 Usage
Properties
1. Chemical compound
2. Molecular formula: C13H16N2
3. Imidazole derivative
4. Benzyl group substituted with two methyl groups at the 2 and 6 positions
5. Known for various pharmacological properties
6. Used as a ligand in coordination chemistry
7. Used as a building block in the synthesis of biologically active compounds
8. Important compound in chemical and pharmaceutical industries
Specific content
Benzyl group substituted with two methyl groups at the 2 and 6 positions
Pharmacological properties
anti-inflammatory, antifungal, antibacterial activities
Versatile compound with potential applications in organic synthesis and pharmaceutical research
Check Digit Verification of cas no
The CAS Registry Mumber 78892-44-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,8,9 and 2 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 78892-44:
(7*7)+(6*8)+(5*8)+(4*9)+(3*2)+(2*4)+(1*4)=191
191 % 10 = 1
So 78892-44-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2/c1-9-4-3-5-10(2)12(9)6-11-7-13-8-14-11/h3-5,7-8H,6H2,1-2H3,(H,13,14)