78946-83-5 Usage
General Description
"(14R*,18R*)-14,18-dimethyl-1,4,7,10,13-pentaoxa-16-azacyclooctadecane" is a chemical compound with the molecular formula C13H29NO5. It is a cyclic compound containing both oxygen and nitrogen atoms in its structure. This chemical is also known as a macrocycle, which is a large ring-shaped molecule consisting of at least twelve atoms. The presence of the oxygen and nitrogen atoms in the compound makes it a potential candidate for applications in pharmaceuticals and materials science. Additionally, the presence of the methyl groups contributes to the compound's overall structure and properties, making it a unique and potentially valuable chemical compound for research and development in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 78946-83-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,8,9,4 and 6 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 78946-83:
(7*7)+(6*8)+(5*9)+(4*4)+(3*6)+(2*8)+(1*3)=195
195 % 10 = 5
So 78946-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H29NO5/c1-13-11-15-12-14(2)20-10-8-18-6-4-16-3-5-17-7-9-19-13/h13-15H,3-12H2,1-2H3
78946-83-5Relevant articles and documents
Synthesis of Monoaza Crown Ethers from N,N-Diamines and Oligoethylene Glycol Di(p-toluenesulfonates) or Corresponding Dichlorides
Maeda, Hirokazu,Furuyoshi, Shigeo,Nakatsuji, Yohji,Okahara, Mitsuo
, p. 212 - 218 (2007/10/02)
Monoaza crown ethers were prepared in satisfactory yields by the one-step reaction between diethanolamine or N,N-diamines and oligoethylene glycol di(p-toluenesulfonates) or corresponding dichlorides in t-butyl alcohol/dioxane in the presence of sodium or potassium t-butoxide.The reaction conditions in the preparation of monoaza 15- and 18-crown ethers were studied.Various monoaza crown ethers having substituents were also prepared and their properties were investigated.
