79261-49-7 Usage
General Description
Potassium 2-(4-isobutylphenyl)propionate is a chemical compound that is commonly used as a food preservative. It is a potassium salt of 2-(4-isobutylphenyl)propionic acid, which belongs to the class of compounds known as benzoic acid and derivatives. potassium 2-(4-isobutylphenyl)propionate is known for its ability to inhibit the growth of mold and bacteria, making it an effective preservative for various food products. Additionally, it is also used in the pharmaceutical industry as a stabilizer for drug formulations. Overall, potassium 2-(4-isobutylphenyl)propionate plays a crucial role in extending the shelf life of food products and maintaining the stability of pharmaceutical formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 79261-49-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,2,6 and 1 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 79261-49:
(7*7)+(6*9)+(5*2)+(4*6)+(3*1)+(2*4)+(1*9)=157
157 % 10 = 7
So 79261-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O2.K/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;/h4-7,9-10H,8H2,1-3H3,(H,14,15);/q;+1/p-1
