79538-28-6 Usage
Description
Methyl 2,4,6-trifluorobenzoate is an organic compound characterized by its trifluorinated benzoate structure. It is a derivative of benzoic acid, where three of the hydrogen atoms on the benzene ring are replaced by fluorine atoms, and a methyl group is attached to the oxygen of the benzoate ion. Methyl 2,4,6-trifluorobenzoate is known for its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Methyl 2,4,6-trifluorobenzoate is used as a key intermediate in the synthesis of hydroxyimidazolidinone compounds. These compounds serve as inhibitors of indoleamine 2,3-dioxygenase (IDO), an enzyme involved in the metabolism of tryptophan. IDO inhibitors have potential therapeutic applications in various conditions, including autoimmune diseases, neurodegenerative disorders, and cancer, due to their ability to modulate immune responses and reduce inflammation.
In the preparation of hydroxyimidazolidinone compounds, Methyl 2,4,6-trifluorobenzoate plays a crucial role in the development of novel IDO inhibitors with improved potency, selectivity, and pharmacokinetic properties. These inhibitors can be further optimized and developed into potential drug candidates for the treatment of various diseases and disorders associated with dysregulated IDO activity.
Check Digit Verification of cas no
The CAS Registry Mumber 79538-28-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,5,3 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 79538-28:
(7*7)+(6*9)+(5*5)+(4*3)+(3*8)+(2*2)+(1*8)=176
176 % 10 = 6
So 79538-28-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F3O2/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3H,1H3
79538-28-6Relevant articles and documents
Synthesis and biological evaluation of indazole derivatives
Claramunt, Rosa M.,López, Concepción,López, Ana,Pérez-Medina, Carlos,Pérez-Torralba, Marta,Alkorta, Ibon,Elguero, José,Escames, Germaine,Acu?a-Castroviejo, Darío
experimental part, p. 1439 - 1447 (2011/04/24)
The inhibition of neuronal and inducible nitric oxide synthases (nNOS and iNOS) by a series of 36 indazoles has been evaluated, showing that most of the assayed derivatives are better iNOS than nNOS inhibitors. A parabolic model relating the iNOS inhibiti
