80822-15-7 Usage
Description
(+)-Dibenzoyl-D-tartaric acid monohydrate is a chiral compound derived from D-tartaric acid, featuring a monohydrate crystal structure and two benzoyl groups attached to the tartaric acid moiety. This organic compound exhibits unique stereochemistry and properties, making it valuable in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
(+)-Dibenzoyl-D-tartaric acid monohydrate is used as a pharmaceutical raw material for the synthesis of various chiral drugs. Its unique stereochemistry allows for the creation of enantiomerically pure compounds, which is crucial for ensuring the desired therapeutic effects and minimizing potential side effects.
Used in Chiral Separation:
(+)-Dibenzoyl-D-tartaric acid monohydrate is used as a chiral separation agent for amines. It plays a vital role in the resolution of racemic mixtures, enabling the isolation of individual enantiomers. This is particularly important in the synthesis of enantiomerically pure compounds, as the biological activity of chiral molecules can vary significantly between their enantiomers.
Used in Racemization:
(+)-Dibenzoyl-D-tartaric acid monohydrate is also employed as a racemization agent for amines. It facilitates the interconversion of enantiomers, which can be useful in various chemical and pharmaceutical processes. This property allows for the production of racemic mixtures or the enrichment of a specific enantiomer, depending on the desired outcome.
Check Digit Verification of cas no
The CAS Registry Mumber 80822-15-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,8,2 and 2 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 80822-15:
(7*8)+(6*0)+(5*8)+(4*2)+(3*2)+(2*1)+(1*5)=117
117 % 10 = 7
So 80822-15-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H14O8.H2O/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12;/h1-10,13-14H,(H,19,20)(H,21,22);1H2/t13-,14-;/m0./s1