83732-73-4 Usage
Chemical class
1-methyl-5-oxopyrrolidine-2-acetohydrazide is a chemical compound.
Derivatives
It is a derivative of pyrrolidine and hydrazide.
Usage
Commonly used in pharmaceutical research and development.
Potential applications
Synthesis of various pharmaceuticals and biologically active molecules.
Scaffold potential
Studied for its potential as a scaffold for the development of new drugs.
Unique features
Has a unique chemical structure and reactivity.
Functional group
Acetohydrazide functional group.
Opportunities
Provides opportunities for the development of novel hydrazide-based drugs and prodrugs.
Promise
Holds promise for its potential role in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 83732-73-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,3 and 2 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 83732-73:
(7*8)+(6*3)+(5*7)+(4*3)+(3*2)+(2*7)+(1*3)=144
144 % 10 = 4
So 83732-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3O2/c1-10-5(2-3-7(10)12)4-6(11)9-8/h5H,2-4,8H2,1H3,(H,9,11)